C23H27N5S — CID 3436782
1-[(1-benzyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-phenylthiourea (PubChem CID 3436782) has the molecular formula C23H27N5S and a molecular weight of 405.57 g/mol. Its IUPAC name is 1-[(1-benzyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-phenylthiourea.
| Compound Name | 1-[(1-benzyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 3436782 |
| Molecular Formula | C23H27N5S |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-[(1-benzyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-ylidene)amino]-3-phenylthiourea |
| SMILES | S=C(NN=C1C2CN3CCN(C2)CC1(Cc1ccccc1)C3)Nc1ccccc1 |
| InChI | InChI=1S/C23H27N5S/c29-22(24-20-9-5-2-6-10-20)26-25-21-19-14-27-11-12-28(15-19)17-23(21,16-27)13-18-7-3-1-4-8-18/h1-10,19H,11-17H2,(H2,24,26,29) |
| InChIKey | VCTNOKWGKYQUJQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|