C24H20N6O2S2 — CID 15682850
1-[(Z)-[(2Z)-1,2-bis(furan-2-yl)-2-(phenylcarbamothioylhydrazinylidene)ethylidene]amino]-3-phenylthiourea (PubChem CID 15682850) has the molecular formula C24H20N6O2S2 and a molecular weight of 488.60 g/mol. Its IUPAC name is 1-[(Z)-[(2Z)-1,2-bis(furan-2-yl)-2-(phenylcarbamothioylhydrazinylidene)ethylidene]amino]-3-phenylthiourea.
| Compound Name | 1-[(Z)-[(2Z)-1,2-bis(furan-2-yl)-2-(phenylcarbamothioylhydrazinylidene)ethylidene]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 15682850 |
| Molecular Formula | C24H20N6O2S2 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 1-[(Z)-[(2Z)-1,2-bis(furan-2-yl)-2-(phenylcarbamothioylhydrazinylidene)ethylidene]amino]-3-phenylthiourea |
| SMILES | S=C(N/N=C(C(=N/NC(=S)Nc1ccccc1)/c1ccco1)\c1ccco1)Nc1ccccc1 |
| InChI | InChI=1S/C24H20N6O2S2/c33-23(25-17-9-3-1-4-10-17)29-27-21(19-13-7-15-31-19)22(20-14-8-16-32-20)28-30-24(34)26-18-11-5-2-6-12-18/h1-16H,(H2,25,29,33)(H2,26,30,34)/b27-21+,28-22+ |
| InChIKey | UJDFYASSMHFAJO-GPAWKIAZSA-N |
| XLogP | 4.95 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|