About 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea
1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea (PubChem CID 21240951) has the molecular formula C24H21N3OS
and a molecular weight of 399.52 g/mol. Its IUPAC name is 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea.
Molecular Properties
| Compound Name | 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea |
| PubChem CID | 21240951 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea |
| SMILES | OC1(c2ccccc2)C/C(=N/NC(=S)Nc2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C24H21N3OS/c28-24(19-12-6-2-7-13-19)17-21(16-22(24)18-10-4-1-5-11-18)26-27-23(29)25-20-14-8-3-9-15-20/h1-16,28H,17H2,(H2,25,27,29)/b26-21+ |
| InChIKey | CHZPNYMAQPLTKN-YYADALCUSA-N |
| XLogP | 4.70 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea?
The IUPAC name of 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea (CID 21240951) is 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea.
What is the SMILES notation for 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea?
The canonical SMILES for 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea is OC1(c2ccccc2)C/C(=N/NC(=S)Nc2ccccc2)C=C1c1ccccc1.
What is the InChIKey of 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea?
The InChIKey is CHZPNYMAQPLTKN-YYADALCUSA-N. The full InChI is InChI=1S/C24H21N3OS/c28-24(19-12-6-2-7-13-19)17-21(16-22(24)18-10-4-1-5-11-18)26-27-23(29)25-20-14-8-3-9-15-20/h1-16,28H,17H2,(H2,25,27,29)/b26-21+.
What are the key properties of 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea?
1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea has a molecular weight of 399.52 g/mol, XLogP of 4.70, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-(4-hydroxy-3,4-diphenylcyclopent-2-en-1-ylidene)amino]-3-phenylthiourea is sourced from PubChem (CID 21240951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).