C17H16FN3S — CID 9410649
1-[(E)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-3-(4-fluorophenyl)thiourea (PubChem CID 9410649) has the molecular formula C17H16FN3S and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[(E)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(E)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9410649 |
| Molecular Formula | C17H16FN3S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-[(E)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-3-(4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)N/N=C2\CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C17H16FN3S/c18-14-6-9-15(10-7-14)19-17(22)21-20-16-8-5-12-3-1-2-4-13(12)11-16/h1-4,6-7,9-10H,5,8,11H2,(H2,19,21,22)/b20-16+ |
| InChIKey | GSSNJNFZCAJQBS-CAPFRKAQSA-N |
| XLogP | 3.66 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|