C17H16FN3S — CID 8870866
1-(1,3-dihydroinden-2-ylideneamino)-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 8870866) has the molecular formula C17H16FN3S and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-(1,3-dihydroinden-2-ylideneamino)-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-(1,3-dihydroinden-2-ylideneamino)-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8870866 |
| Molecular Formula | C17H16FN3S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(1,3-dihydroinden-2-ylideneamino)-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | Fc1ccc(CNC(=S)NN=C2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C17H16FN3S/c18-15-7-5-12(6-8-15)11-19-17(22)21-20-16-9-13-3-1-2-4-14(13)10-16/h1-8H,9-11H2,(H2,19,21,22) |
| InChIKey | CMWZCADKEJSDFV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|