C23H23FN2S — CID 19650233
1-(3,3-diphenylpropyl)-3-[(4-fluorophenyl)methyl]thiourea (PubChem CID 19650233) has the molecular formula C23H23FN2S and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 1-(3,3-diphenylpropyl)-3-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 19650233 |
| Molecular Formula | C23H23FN2S |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-[(4-fluorophenyl)methyl]thiourea |
| SMILES | Fc1ccc(CNC(=S)NCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23FN2S/c24-21-13-11-18(12-14-21)17-26-23(27)25-16-15-22(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,22H,15-17H2,(H2,25,26,27) |
| InChIKey | GMBHZNSHOVJHEV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|