C17H19FN2O2 — CID 97038671
1-[(4-fluorophenyl)methyl]-3-[(3R)-3-hydroxy-3-phenylpropyl]urea (PubChem CID 97038671) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[(3R)-3-hydroxy-3-phenylpropyl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[(3R)-3-hydroxy-3-phenylpropyl]urea |
|---|---|
| PubChem CID | 97038671 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[(3R)-3-hydroxy-3-phenylpropyl]urea |
| SMILES | O=C(NCC[C@@H](O)c1ccccc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H19FN2O2/c18-15-8-6-13(7-9-15)12-20-17(22)19-11-10-16(21)14-4-2-1-3-5-14/h1-9,16,21H,10-12H2,(H2,19,20,22)/t16-/m1/s1 |
| InChIKey | AEHZKXFKXQSTRO-MRXNPFEDSA-N |
| XLogP | 2.75 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |