C21H22N4O — CID 5467984
1,3-bis[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]urea (PubChem CID 5467984) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 1,3-bis[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]urea.
| Compound Name | 1,3-bis[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]urea |
|---|---|
| PubChem CID | 5467984 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1,3-bis[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]urea |
| SMILES | O=C(N/N=C1/CCc2ccccc2C1)N/N=C1/CCc2ccccc2C1 |
| InChI | InChI=1S/C21H22N4O/c26-21(24-22-19-11-9-15-5-1-3-7-17(15)13-19)25-23-20-12-10-16-6-2-4-8-18(16)14-20/h1-8H,9-14H2,(H2,24,25,26)/b22-19-,23-20- |
| InChIKey | PQJQIEQYWXYVAC-IKJQKJQYSA-N |
| XLogP | 3.38 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|