C18H17FN2OS — CID 9410856
N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-2-(2-fluorophenyl)sulfanylacetamide (PubChem CID 9410856) has the molecular formula C18H17FN2OS and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-2-(2-fluorophenyl)sulfanylacetamide.
| Compound Name | N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-2-(2-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 9410856 |
| Molecular Formula | C18H17FN2OS |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-2-(2-fluorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccccc1F)N/N=C1/CCc2ccccc2C1 |
| InChI | InChI=1S/C18H17FN2OS/c19-16-7-3-4-8-17(16)23-12-18(22)21-20-15-10-9-13-5-1-2-6-14(13)11-15/h1-8H,9-12H2,(H,21,22)/b20-15- |
| InChIKey | LGTXDKBRPSJCLD-HKWRFOASSA-N |
| XLogP | 3.58 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|