C25H20N4O2 — CID 9410888
N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-4-oxo-3-phenylphthalazine-1-carboxamide (PubChem CID 9410888) has the molecular formula C25H20N4O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-4-oxo-3-phenylphthalazine-1-carboxamide.
| Compound Name | N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-4-oxo-3-phenylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9410888 |
| Molecular Formula | C25H20N4O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-4-oxo-3-phenylphthalazine-1-carboxamide |
| SMILES | O=C(N/N=C1/CCc2ccccc2C1)c1nn(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C25H20N4O2/c30-24(27-26-19-15-14-17-8-4-5-9-18(17)16-19)23-21-12-6-7-13-22(21)25(31)29(28-23)20-10-2-1-3-11-20/h1-13H,14-16H2,(H,27,30)/b26-19- |
| InChIKey | VRKVTNIIEAQYEW-XHPQRKPJSA-N |
| XLogP | 3.66 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|