C14H12N2OS — CID 4923007
N-(1,3-dihydroinden-2-ylideneamino)thiophene-2-carboxamide (PubChem CID 4923007) has the molecular formula C14H12N2OS and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(1,3-dihydroinden-2-ylideneamino)thiophene-2-carboxamide.
| Compound Name | N-(1,3-dihydroinden-2-ylideneamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4923007 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-(1,3-dihydroinden-2-ylideneamino)thiophene-2-carboxamide |
| SMILES | O=C(NN=C1Cc2ccccc2C1)c1cccs1 |
| InChI | InChI=1S/C14H12N2OS/c17-14(13-6-3-7-18-13)16-15-12-8-10-4-1-2-5-11(10)9-12/h1-7H,8-9H2,(H,16,17) |
| InChIKey | DPVWBTNJTDHRQO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|