C17H16ClN3O3S — CID 9410831
4-chloro-N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-3-sulfamoylbenzamide (PubChem CID 9410831) has the molecular formula C17H16ClN3O3S and a molecular weight of 377.85 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 9410831 |
| Molecular Formula | C17H16ClN3O3S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 4-chloro-N-[(Z)-3,4-dihydro-1H-naphthalen-2-ylideneamino]-3-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)N/N=C2/CCc3ccccc3C2)ccc1Cl |
| InChI | InChI=1S/C17H16ClN3O3S/c18-15-8-6-13(10-16(15)25(19,23)24)17(22)21-20-14-7-5-11-3-1-2-4-12(11)9-14/h1-4,6,8,10H,5,7,9H2,(H,21,22)(H2,19,23,24)/b20-14- |
| InChIKey | YLMPPRLRBRAZPN-ZHZULCJRSA-N |
| XLogP | 2.26 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|