C15H13ClFN3O4S — CID 135582534
4-chloro-N-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-3-sulfamoylbenzamide (PubChem CID 135582534) has the molecular formula C15H13ClFN3O4S and a molecular weight of 385.80 g/mol. Its IUPAC name is 4-chloro-N-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 135582534 |
| Molecular Formula | C15H13ClFN3O4S |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 4-chloro-N-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-3-sulfamoylbenzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1)c1cc(F)ccc1O |
| InChI | InChI=1S/C15H13ClFN3O4S/c1-8(11-7-10(17)3-5-13(11)21)19-20-15(22)9-2-4-12(16)14(6-9)25(18,23)24/h2-7,21H,1H3,(H,20,22)(H2,18,23,24)/b19-8+ |
| InChIKey | CTOHMDUEWVJDCX-UFWORHAWSA-N |
| XLogP | 1.99 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|