C15H22ClN3O3S — CID 10247913
4-chloro-N-[(E)-octylideneamino]-3-sulfamoylbenzamide (PubChem CID 10247913) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is 4-chloro-N-[(E)-octylideneamino]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[(E)-octylideneamino]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 10247913 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-chloro-N-[(E)-octylideneamino]-3-sulfamoylbenzamide |
| SMILES | CCCCCCC/C=N/NC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H22ClN3O3S/c1-2-3-4-5-6-7-10-18-19-15(20)12-8-9-13(16)14(11-12)23(17,21)22/h8-11H,2-7H2,1H3,(H,19,20)(H2,17,21,22)/b18-10+ |
| InChIKey | LCDVDOLIQVEFSP-VCHYOVAHSA-N |
| XLogP | 3.06 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|