C16H16ClN3O4S — CID 9395667
4-chloro-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-3-sulfamoylbenzamide (PubChem CID 9395667) has the molecular formula C16H16ClN3O4S and a molecular weight of 381.84 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 9395667 |
| Molecular Formula | C16H16ClN3O4S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 4-chloro-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-3-sulfamoylbenzamide |
| SMILES | C[C@H]1C[C@@H]1c1ccc(/C=N\NC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)o1 |
| InChI | InChI=1S/C16H16ClN3O4S/c1-9-6-12(9)14-5-3-11(24-14)8-19-20-16(21)10-2-4-13(17)15(7-10)25(18,22)23/h2-5,7-9,12H,6H2,1H3,(H,20,21)(H2,18,22,23)/b19-8-/t9-,12-/m0/s1 |
| InChIKey | FNIIGFOUISVRGF-MOSBXJRMSA-N |
| XLogP | 2.47 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|