C15H14Cl3N4O2+ — CID 135590406
4-amino-3,5,6-trichloro-N-[(E)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]pyridin-1-ium-2-carboxamide (PubChem CID 135590406) has the molecular formula C15H14Cl3N4O2+ and a molecular weight of 388.66 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135590406 |
| Molecular Formula | C15H14Cl3N4O2+ |
| Molecular Weight | 388.66 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]pyridin-1-ium-2-carboxamide |
| SMILES | C[C@@H]1C[C@H]1c1ccc(/C=N/NC(=O)c2[nH+]c(Cl)c(Cl)c(N)c2Cl)o1 |
| InChI | InChI=1S/C15H13Cl3N4O2/c1-6-4-8(6)9-3-2-7(24-9)5-20-22-15(23)13-10(16)12(19)11(17)14(18)21-13/h2-3,5-6,8H,4H2,1H3,(H2,19,21)(H,22,23)/p+1/b20-5+/t6-,8-/m1/s1 |
| InChIKey | AACVBBCCAOVRLK-XTDUJZPUSA-O |
| XLogP | 3.52 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|