C20H24N2O4 — CID 9396622
3-methoxy-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-4-propan-2-yloxybenzamide (PubChem CID 9396622) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 3-methoxy-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-4-propan-2-yloxybenzamide.
| Compound Name | 3-methoxy-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 9396622 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3-methoxy-N-[(Z)-[5-[(1S,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-4-propan-2-yloxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C\c2ccc([C@H]3C[C@H]3C)o2)ccc1OC(C)C |
| InChI | InChI=1S/C20H24N2O4/c1-12(2)25-18-7-5-14(10-19(18)24-4)20(23)22-21-11-15-6-8-17(26-15)16-9-13(16)3/h5-8,10-13,16H,9H2,1-4H3,(H,22,23)/b21-11-/t13-,16+/m1/s1 |
| InChIKey | ATXYDJHYXOHEKW-CPFMVOSDSA-N |
| XLogP | 3.96 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|