C22H22N2O3 — CID 9395177
(2R)-N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-naphthalen-2-yloxypropanamide (PubChem CID 9395177) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2R)-N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-naphthalen-2-yloxypropanamide.
| Compound Name | (2R)-N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-naphthalen-2-yloxypropanamide |
|---|---|
| PubChem CID | 9395177 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (2R)-N-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-naphthalen-2-yloxypropanamide |
| SMILES | C[C@@H](Oc1ccc2ccccc2c1)C(=O)N/N=C\c1ccc([C@@H]2C[C@@H]2C)o1 |
| InChI | InChI=1S/C22H22N2O3/c1-14-11-20(14)21-10-9-19(27-21)13-23-24-22(25)15(2)26-18-8-7-16-5-3-4-6-17(16)12-18/h3-10,12-15,20H,11H2,1-2H3,(H,24,25)/b23-13-/t14-,15+,20+/m0/s1 |
| InChIKey | CANQFBDAAMTOSC-XEGPXUGZSA-N |
| XLogP | 4.47 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|