C20H24N2O3 — CID 11940670
(2S)-2-(2,3-dimethylphenoxy)-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]propanamide (PubChem CID 11940670) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (2S)-2-(2,3-dimethylphenoxy)-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]propanamide.
| Compound Name | (2S)-2-(2,3-dimethylphenoxy)-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 11940670 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2S)-2-(2,3-dimethylphenoxy)-N-[(Z)-[5-[(1S,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]propanamide |
| SMILES | Cc1cccc(O[C@@H](C)C(=O)N/N=C\c2ccc([C@H]3C[C@@H]3C)o2)c1C |
| InChI | InChI=1S/C20H24N2O3/c1-12-6-5-7-18(14(12)3)24-15(4)20(23)22-21-11-16-8-9-19(25-16)17-10-13(17)2/h5-9,11,13,15,17H,10H2,1-4H3,(H,22,23)/b21-11-/t13-,15-,17-/m0/s1 |
| InChIKey | IRYZZNFMKAOVPB-MCPVGDJYSA-N |
| XLogP | 3.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|