C15H14Cl3N4O3+ — CID 135905967
4-amino-3,5,6-trichloro-N-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]pyridin-1-ium-2-carboxamide (PubChem CID 135905967) has the molecular formula C15H14Cl3N4O3+ and a molecular weight of 404.66 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135905967 |
| Molecular Formula | C15H14Cl3N4O3+ |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]pyridin-1-ium-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2[nH+]c(Cl)c(Cl)c(N)c2Cl)cc(OC)c1 |
| InChI | InChI=1S/C15H13Cl3N4O3/c1-24-8-3-7(4-9(5-8)25-2)6-20-22-15(23)13-10(16)12(19)11(17)14(18)21-13/h3-6H,1-2H3,(H2,19,21)(H,22,23)/p+1/b20-6- |
| InChIKey | WCWBEERQVNBDQA-IOXNKQMXSA-O |
| XLogP | 2.82 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|