C23H26N4O7 — CID 44621401
N,N'-bis[(E)-(3,5-dimethoxyphenyl)methylideneamino]-3-oxopentanediamide (PubChem CID 44621401) has the molecular formula C23H26N4O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is N,N'-bis[(E)-(3,5-dimethoxyphenyl)methylideneamino]-3-oxopentanediamide.
| Compound Name | N,N'-bis[(E)-(3,5-dimethoxyphenyl)methylideneamino]-3-oxopentanediamide |
|---|---|
| PubChem CID | 44621401 |
| Molecular Formula | C23H26N4O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N,N'-bis[(E)-(3,5-dimethoxyphenyl)methylideneamino]-3-oxopentanediamide |
| SMILES | COc1cc(/C=N/NC(=O)CC(=O)CC(=O)N/N=C/c2cc(OC)cc(OC)c2)cc(OC)c1 |
| InChI | InChI=1S/C23H26N4O7/c1-31-18-5-15(6-19(11-18)32-2)13-24-26-22(29)9-17(28)10-23(30)27-25-14-16-7-20(33-3)12-21(8-16)34-4/h5-8,11-14H,9-10H2,1-4H3,(H,26,29)(H,27,30)/b24-13+,25-14+ |
| InChIKey | VAZVOUFZKPCPLQ-GUJRAXHGSA-N |
| XLogP | 1.67 |
| TPSA | 136.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|