C20H22N4O5 — CID 167451082
N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]-2-[(Z)-[(4-methoxyphenyl)-(methylideneamino)methylidene]amino]oxyacetamide (PubChem CID 167451082) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]-2-[(Z)-[(4-methoxyphenyl)-(methylideneamino)methylidene]amino]oxyacetamide.
| Compound Name | N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]-2-[(Z)-[(4-methoxyphenyl)-(methylideneamino)methylidene]amino]oxyacetamide |
|---|---|
| PubChem CID | 167451082 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]-2-[(Z)-[(4-methoxyphenyl)-(methylideneamino)methylidene]amino]oxyacetamide |
| SMILES | C=N/C(=N\OCC(=O)N/N=C/c1cc(OC)cc(OC)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H22N4O5/c1-21-20(15-5-7-16(26-2)8-6-15)24-29-13-19(25)23-22-12-14-9-17(27-3)11-18(10-14)28-4/h5-12H,1,13H2,2-4H3,(H,23,25)/b22-12+,24-20- |
| InChIKey | YXGJQMAHZSFZDQ-KEJZAOJNSA-N |
| XLogP | 2.24 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|