C12H16N2O4 — CID 2643044
ethyl N-[(3,5-dimethoxyphenyl)methylideneamino]carbamate (PubChem CID 2643044) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl N-[(3,5-dimethoxyphenyl)methylideneamino]carbamate.
| Compound Name | ethyl N-[(3,5-dimethoxyphenyl)methylideneamino]carbamate |
|---|---|
| PubChem CID | 2643044 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | ethyl N-[(3,5-dimethoxyphenyl)methylideneamino]carbamate |
| SMILES | CCOC(=O)NN=Cc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C12H16N2O4/c1-4-18-12(15)14-13-8-9-5-10(16-2)7-11(6-9)17-3/h5-8H,4H2,1-3H3,(H,14,15) |
| InChIKey | OOVJUSKPFUVGFK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|