C12H16Cl3N4O+ — CID 135850574
4-amino-3,5,6-trichloro-N-[(E)-2-ethylbutylideneamino]pyridin-1-ium-2-carboxamide (PubChem CID 135850574) has the molecular formula C12H16Cl3N4O+ and a molecular weight of 338.65 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-2-ethylbutylideneamino]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-2-ethylbutylideneamino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135850574 |
| Molecular Formula | C12H16Cl3N4O+ |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-2-ethylbutylideneamino]pyridin-1-ium-2-carboxamide |
| SMILES | CCC(/C=N/NC(=O)c1[nH+]c(Cl)c(Cl)c(N)c1Cl)CC |
| InChI | InChI=1S/C12H15Cl3N4O/c1-3-6(4-2)5-17-19-12(20)10-7(13)9(16)8(14)11(15)18-10/h5-6H,3-4H2,1-2H3,(H2,16,18)(H,19,20)/p+1/b17-5+ |
| InChIKey | IHYNKANETPIBTL-YAXRCOADSA-O |
| XLogP | 3.19 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|