C16H18Cl3N4O+ — CID 135830089
4-amino-3,5,6-trichloro-N-[(E)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]pyridin-1-ium-2-carboxamide (PubChem CID 135830089) has the molecular formula C16H18Cl3N4O+ and a molecular weight of 388.71 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135830089 |
| Molecular Formula | C16H18Cl3N4O+ |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]pyridin-1-ium-2-carboxamide |
| SMILES | CC1(C)[C@@H]2CC=C(/C=N/NC(=O)c3[nH+]c(Cl)c(Cl)c(N)c3Cl)[C@H]1C2 |
| InChI | InChI=1S/C16H17Cl3N4O/c1-16(2)8-4-3-7(9(16)5-8)6-21-23-15(24)13-10(17)12(20)11(18)14(19)22-13/h3,6,8-9H,4-5H2,1-2H3,(H2,20,22)(H,23,24)/p+1/b21-6+/t8-,9-/m1/s1 |
| InChIKey | FGJNYFXZKUUTPQ-QWOZDJRYSA-O |
| XLogP | 3.75 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|