C21H27N3O3S — CID 11936702
N-[(Z)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 11936702) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[(Z)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(Z)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 11936702 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[(Z)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CC1(C)[C@@H]2CC=C(/C=N\NC(=O)c3cccc(S(=O)(=O)N4CCCC4)c3)[C@H]1C2 |
| InChI | InChI=1S/C21H27N3O3S/c1-21(2)17-9-8-16(19(21)13-17)14-22-23-20(25)15-6-5-7-18(12-15)28(26,27)24-10-3-4-11-24/h5-8,12,14,17,19H,3-4,9-11,13H2,1-2H3,(H,23,25)/b22-14-/t17-,19-/m1/s1 |
| InChIKey | QQSSEEPYPNQEEG-MMPVQFPMSA-N |
| XLogP | 3.18 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|