C20H26N2O2 — CID 29226307
N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2-(2,5-dimethylphenoxy)acetamide (PubChem CID 29226307) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2-(2,5-dimethylphenoxy)acetamide.
| Compound Name | N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2-(2,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 29226307 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2-(2,5-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)N/N=C\C2=CC[C@H]3C[C@@H]2C3(C)C)c1 |
| InChI | InChI=1S/C20H26N2O2/c1-13-5-6-14(2)18(9-13)24-12-19(23)22-21-11-15-7-8-16-10-17(15)20(16,3)4/h5-7,9,11,16-17H,8,10,12H2,1-4H3,(H,22,23)/b21-11-/t16-,17-/m0/s1 |
| InChIKey | JRHHNXRSYVBZFO-FPHNSIFGSA-N |
| XLogP | 3.78 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|