C14H11Cl3N5O3+ — CID 135911889
4-amino-3,5,6-trichloro-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]pyridin-1-ium-2-carboxamide (PubChem CID 135911889) has the molecular formula C14H11Cl3N5O3+ and a molecular weight of 403.63 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135911889 |
| Molecular Formula | C14H11Cl3N5O3+ |
| Molecular Weight | 403.63 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]pyridin-1-ium-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1[nH+]c(Cl)c(Cl)c(N)c1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H10Cl3N5O3/c1-6(7-2-4-8(5-3-7)22(24)25)20-21-14(23)12-9(15)11(18)10(16)13(17)19-12/h2-5H,1H3,(H2,18,19)(H,21,23)/p+1/b20-6- |
| InChIKey | IHHSOROKSOHGFR-IOXNKQMXSA-O |
| XLogP | 3.11 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|