C16H14Cl3N4O2+ — CID 135904782
4-amino-3,5,6-trichloro-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]pyridin-1-ium-2-carboxamide (PubChem CID 135904782) has the molecular formula C16H14Cl3N4O2+ and a molecular weight of 400.67 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135904782 |
| Molecular Formula | C16H14Cl3N4O2+ |
| Molecular Weight | 400.67 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(Z)-(3-prop-2-enoxyphenyl)methylideneamino]pyridin-1-ium-2-carboxamide |
| SMILES | C=CCOc1cccc(/C=N\NC(=O)c2[nH+]c(Cl)c(Cl)c(N)c2Cl)c1 |
| InChI | InChI=1S/C16H13Cl3N4O2/c1-2-6-25-10-5-3-4-9(7-10)8-21-23-16(24)14-11(17)13(20)12(18)15(19)22-14/h2-5,7-8H,1,6H2,(H2,20,22)(H,23,24)/p+1/b21-8- |
| InChIKey | WVLINHYYRZDQIZ-WNFQYIGGSA-O |
| XLogP | 3.37 |
| TPSA | 90.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|