C28H31N3O3S — CID 52918151
1-[[2,6-bis(4-methoxyphenyl)-3,5-dimethyloxan-4-ylidene]amino]-3-phenylthiourea (PubChem CID 52918151) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is 1-[[2,6-bis(4-methoxyphenyl)-3,5-dimethyloxan-4-ylidene]amino]-3-phenylthiourea.
| Compound Name | 1-[[2,6-bis(4-methoxyphenyl)-3,5-dimethyloxan-4-ylidene]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 52918151 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 1-[[2,6-bis(4-methoxyphenyl)-3,5-dimethyloxan-4-ylidene]amino]-3-phenylthiourea |
| SMILES | COc1ccc(C2OC(c3ccc(OC)cc3)C(C)C(=NNC(=S)Nc3ccccc3)C2C)cc1 |
| InChI | InChI=1S/C28H31N3O3S/c1-18-25(30-31-28(35)29-22-8-6-5-7-9-22)19(2)27(21-12-16-24(33-4)17-13-21)34-26(18)20-10-14-23(32-3)15-11-20/h5-19,26-27H,1-4H3,(H2,29,31,35) |
| InChIKey | SZGIBRNHGBOMHO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|