C22H29NS — CID 167260137
(8-tert-butyl-9b,10-dihydro-4bH-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane (PubChem CID 167260137) has the molecular formula C22H29NS and a molecular weight of 339.55 g/mol. Its IUPAC name is (8-tert-butyl-9b,10-dihydro-4bH-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane.
| Compound Name | (8-tert-butyl-9b,10-dihydro-4bH-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 167260137 |
| Molecular Formula | C22H29NS |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (8-tert-butyl-9b,10-dihydro-4bH-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane |
| SMILES | CC(C)(C)c1ccc2c(c1)C1Cc3ccccc3C1N2S(C)(C)C |
| InChI | InChI=1S/C22H29NS/c1-22(2,3)16-11-12-20-18(14-16)19-13-15-9-7-8-10-17(15)21(19)23(20)24(4,5)6/h7-12,14,19,21H,13H2,1-6H3 |
| InChIKey | LPONLBOYIIMQTF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_indane(1)', 'substructure': 'N/A'} |
|---|