C21H34 — CID 165164993
2,2,5-tritert-butyl-1,3-dihydroindene (PubChem CID 165164993) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is 2,2,5-tritert-butyl-1,3-dihydroindene.
| Compound Name | 2,2,5-tritert-butyl-1,3-dihydroindene |
|---|---|
| PubChem CID | 165164993 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | 2,2,5-tritert-butyl-1,3-dihydroindene |
| SMILES | CC(C)(C)c1ccc2c(c1)CC(C(C)(C)C)(C(C)(C)C)C2 |
| InChI | InChI=1S/C21H34/c1-18(2,3)17-11-10-15-13-21(19(4,5)6,20(7,8)9)14-16(15)12-17/h10-12H,13-14H2,1-9H3 |
| InChIKey | VZXAFAAOGDAIAF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |