C21H28OTi — CID 174395935
2,7-ditert-butyl-1,9-dihydrofluoren-2-ol;titanium (PubChem CID 174395935) has the molecular formula C21H28OTi and a molecular weight of 344.32 g/mol. Its IUPAC name is 2,7-ditert-butyl-1,9-dihydrofluoren-2-ol;titanium.
| Compound Name | 2,7-ditert-butyl-1,9-dihydrofluoren-2-ol;titanium |
|---|---|
| PubChem CID | 174395935 |
| Molecular Formula | C21H28OTi |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2,7-ditert-butyl-1,9-dihydrofluoren-2-ol;titanium |
| SMILES | CC(C)(C)c1ccc2c(c1)CC1=C2C=CC(O)(C(C)(C)C)C1.[Ti] |
| InChI | InChI=1S/C21H28O.Ti/c1-19(2,3)16-7-8-17-14(12-16)11-15-13-21(22,20(4,5)6)10-9-18(15)17;/h7-10,12,22H,11,13H2,1-6H3; |
| InChIKey | JGBOCHJQDSTYLB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |