C19H22S2 — CID 167021696
2-[7-(2-sulfanylpropan-2-yl)-9H-fluoren-2-yl]propane-2-thiol (PubChem CID 167021696) has the molecular formula C19H22S2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 2-[7-(2-sulfanylpropan-2-yl)-9H-fluoren-2-yl]propane-2-thiol.
| Compound Name | 2-[7-(2-sulfanylpropan-2-yl)-9H-fluoren-2-yl]propane-2-thiol |
|---|---|
| PubChem CID | 167021696 |
| Molecular Formula | C19H22S2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[7-(2-sulfanylpropan-2-yl)-9H-fluoren-2-yl]propane-2-thiol |
| SMILES | CC(C)(S)c1ccc2c(c1)Cc1cc(C(C)(C)S)ccc1-2 |
| InChI | InChI=1S/C19H22S2/c1-18(2,20)14-5-7-16-12(10-14)9-13-11-15(19(3,4)21)6-8-17(13)16/h5-8,10-11,20-21H,9H2,1-4H3 |
| InChIKey | YBIDRCDOTAXIRD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|