About 2,6-ditert-butyl-9H-fluorene;dichlorotitanium
2,6-ditert-butyl-9H-fluorene;dichlorotitanium (PubChem CID 174369876) has the molecular formula C21H26Cl2Ti
and a molecular weight of 397.21 g/mol. Its IUPAC name is 2,6-ditert-butyl-9H-fluorene;dichlorotitanium.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-9H-fluorene;dichlorotitanium |
| PubChem CID | 174369876 |
| Molecular Formula | C21H26Cl2Ti |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2,6-ditert-butyl-9H-fluorene;dichlorotitanium |
| SMILES | CC(C)(C)c1ccc2c(c1)Cc1ccc(C(C)(C)C)cc1-2.Cl[Ti]Cl |
| InChI | InChI=1S/C21H26.2ClH.Ti/c1-20(2,3)16-9-10-18-15(12-16)11-14-7-8-17(13-19(14)18)21(4,5)6;;;/h7-10,12-13H,11H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | RVNGFLWNMMTLQD-UHFFFAOYSA-L |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,6-ditert-butyl-9H-fluorene;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-9H-fluorene;dichlorotitanium?
The IUPAC name of 2,6-ditert-butyl-9H-fluorene;dichlorotitanium (CID 174369876) is 2,6-ditert-butyl-9H-fluorene;dichlorotitanium.
What is the SMILES notation for 2,6-ditert-butyl-9H-fluorene;dichlorotitanium?
The canonical SMILES for 2,6-ditert-butyl-9H-fluorene;dichlorotitanium is CC(C)(C)c1ccc2c(c1)Cc1ccc(C(C)(C)C)cc1-2.Cl[Ti]Cl.
What is the InChIKey of 2,6-ditert-butyl-9H-fluorene;dichlorotitanium?
The InChIKey is RVNGFLWNMMTLQD-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H26.2ClH.Ti/c1-20(2,3)16-9-10-18-15(12-16)11-14-7-8-17(13-19(14)18)21(4,5)6;;;/h7-10,12-13H,11H2,1-6H3;2*1H;/q;;;+2/p-2.
What are the key properties of 2,6-ditert-butyl-9H-fluorene;dichlorotitanium?
2,6-ditert-butyl-9H-fluorene;dichlorotitanium has a molecular weight of 397.21 g/mol, XLogP of 7.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-9H-fluorene;dichlorotitanium is sourced from PubChem (CID 174369876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).