C33H33N — CID 158328553
3,6-ditert-butyl-9-(9H-fluoren-2-yl)carbazole (PubChem CID 158328553) has the molecular formula C33H33N and a molecular weight of 443.63 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-(9H-fluoren-2-yl)carbazole.
| Compound Name | 3,6-ditert-butyl-9-(9H-fluoren-2-yl)carbazole |
|---|---|
| PubChem CID | 158328553 |
| Molecular Formula | C33H33N |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 3,6-ditert-butyl-9-(9H-fluoren-2-yl)carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C33H33N/c1-32(2,3)23-11-15-30-28(19-23)29-20-24(33(4,5)6)12-16-31(29)34(30)25-13-14-27-22(18-25)17-21-9-7-8-10-26(21)27/h7-16,18-20H,17H2,1-6H3 |
| InChIKey | FMCMMVWRZVODLL-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |