C17H24 — CID 20675508
3,5-ditert-butyl-1H-indene (PubChem CID 20675508) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 3,5-ditert-butyl-1H-indene.
| Compound Name | 3,5-ditert-butyl-1H-indene |
|---|---|
| PubChem CID | 20675508 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 3,5-ditert-butyl-1H-indene |
| SMILES | CC(C)(C)C1=CCc2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C17H24/c1-16(2,3)13-9-7-12-8-10-15(14(12)11-13)17(4,5)6/h7,9-11H,8H2,1-6H3 |
| InChIKey | UEDCYNXSBCQYBS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |