C18H26 — CID 10263787
2,6-ditert-butyl-1,4-dihydronaphthalene (PubChem CID 10263787) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 2,6-ditert-butyl-1,4-dihydronaphthalene.
| Compound Name | 2,6-ditert-butyl-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 10263787 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2,6-ditert-butyl-1,4-dihydronaphthalene |
| SMILES | CC(C)(C)C1=CCc2cc(C(C)(C)C)ccc2C1 |
| InChI | InChI=1S/C18H26/c1-17(2,3)15-9-7-14-12-16(18(4,5)6)10-8-13(14)11-15/h7,9-11H,8,12H2,1-6H3 |
| InChIKey | CNXSPUMDDXTRQI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|