C24H31Cl — CID 14692240
6,13-ditert-butyl-4-(chloromethyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 14692240) has the molecular formula C24H31Cl and a molecular weight of 354.97 g/mol. Its IUPAC name is 6,13-ditert-butyl-4-(chloromethyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 6,13-ditert-butyl-4-(chloromethyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 14692240 |
| Molecular Formula | C24H31Cl |
| Molecular Weight | 354.97 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 6,13-ditert-butyl-4-(chloromethyl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | CC(C)(C)c1ccc2c(c1)CCc1cc(C(C)(C)C)cc(CCl)c1C2 |
| InChI | InChI=1S/C24H31Cl/c1-23(2,3)20-10-9-17-14-22-18(8-7-16(17)11-20)12-21(24(4,5)6)13-19(22)15-25/h9-13H,7-8,14-15H2,1-6H3 |
| InChIKey | QCWYEHNOUKENSN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.97 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|