C18H26O — CID 13466563
3,6-ditert-butyl-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 13466563) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 3,6-ditert-butyl-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 3,6-ditert-butyl-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 13466563 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 3,6-ditert-butyl-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | CC(C)(C)c1ccc2c(c1)CC(C(C)(C)C)C(=O)C2 |
| InChI | InChI=1S/C18H26O/c1-17(2,3)14-8-7-12-11-16(19)15(18(4,5)6)10-13(12)9-14/h7-9,15H,10-11H2,1-6H3 |
| InChIKey | HFGXJUDHRIXHLA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |