C16H22O2 — CID 82384252
2-(7-tert-butyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid (PubChem CID 82384252) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(7-tert-butyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid.
| Compound Name | 2-(7-tert-butyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid |
|---|---|
| PubChem CID | 82384252 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-(7-tert-butyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid |
| SMILES | CC(C)(C)c1ccc2c(c1)CC(CC(=O)O)CC2 |
| InChI | InChI=1S/C16H22O2/c1-16(2,3)14-7-6-12-5-4-11(9-15(17)18)8-13(12)10-14/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,17,18) |
| InChIKey | ODANWBJXIDPKOE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |