C16H24O — CID 58591214
2,5-ditert-butyl-2,3-dihydro-1-benzofuran (PubChem CID 58591214) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 2,5-ditert-butyl-2,3-dihydro-1-benzofuran.
| Compound Name | 2,5-ditert-butyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 58591214 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2,5-ditert-butyl-2,3-dihydro-1-benzofuran |
| SMILES | CC(C)(C)c1ccc2c(c1)CC(C(C)(C)C)O2 |
| InChI | InChI=1S/C16H24O/c1-15(2,3)12-7-8-13-11(9-12)10-14(17-13)16(4,5)6/h7-9,14H,10H2,1-6H3 |
| InChIKey | PETPEEXBUXDKBZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |