C16H24O — CID 168743383
6-tert-butyl-2-propan-2-yl-3,4-dihydro-2H-chromene (PubChem CID 168743383) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 6-tert-butyl-2-propan-2-yl-3,4-dihydro-2H-chromene.
| Compound Name | 6-tert-butyl-2-propan-2-yl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 168743383 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 6-tert-butyl-2-propan-2-yl-3,4-dihydro-2H-chromene |
| SMILES | CC(C)C1CCc2cc(C(C)(C)C)ccc2O1 |
| InChI | InChI=1S/C16H24O/c1-11(2)14-8-6-12-10-13(16(3,4)5)7-9-15(12)17-14/h7,9-11,14H,6,8H2,1-5H3 |
| InChIKey | HWPKUPNDOSFNTK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |