C16H23U+ — CID 21055230
5-tert-butyl-2,3,3-trimethyl-1H-inden-2-ide;uranium(2+) (PubChem CID 21055230) has the molecular formula C16H23U+ and a molecular weight of 453.39 g/mol. Its IUPAC name is 5-tert-butyl-2,3,3-trimethyl-1H-inden-2-ide;uranium(2+).
| Compound Name | 5-tert-butyl-2,3,3-trimethyl-1H-inden-2-ide;uranium(2+) |
|---|---|
| PubChem CID | 21055230 |
| Molecular Formula | C16H23U+ |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 5-tert-butyl-2,3,3-trimethyl-1H-inden-2-ide;uranium(2+) |
| SMILES | C[C-]1Cc2ccc(C(C)(C)C)cc2C1(C)C.[U+2] |
| InChI | InChI=1S/C16H23.U/c1-11-9-12-7-8-13(15(2,3)4)10-14(12)16(11,5)6;/h7-8,10H,9H2,1-6H3;/q-1;+2 |
| InChIKey | DHTARTLXZVTNTM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|