C15H21Br — CID 79838157
1-bromo-6-tert-butyl-3,3-dimethyl-1,2-dihydroindene (PubChem CID 79838157) has the molecular formula C15H21Br and a molecular weight of 281.24 g/mol. Its IUPAC name is 1-bromo-6-tert-butyl-3,3-dimethyl-1,2-dihydroindene.
| Compound Name | 1-bromo-6-tert-butyl-3,3-dimethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 79838157 |
| Molecular Formula | C15H21Br |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-bromo-6-tert-butyl-3,3-dimethyl-1,2-dihydroindene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(Br)CC2(C)C |
| InChI | InChI=1S/C15H21Br/c1-14(2,3)10-6-7-12-11(8-10)13(16)9-15(12,4)5/h6-8,13H,9H2,1-5H3 |
| InChIKey | DESZIFMXADDULJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|