C24H28N2 — CID 118357276
2-tert-butyl-5-(7-tert-butyl-9H-fluoren-2-yl)-1H-imidazole (PubChem CID 118357276) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-tert-butyl-5-(7-tert-butyl-9H-fluoren-2-yl)-1H-imidazole.
| Compound Name | 2-tert-butyl-5-(7-tert-butyl-9H-fluoren-2-yl)-1H-imidazole |
|---|---|
| PubChem CID | 118357276 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 2-tert-butyl-5-(7-tert-butyl-9H-fluoren-2-yl)-1H-imidazole |
| SMILES | CC(C)(C)c1ccc2c(c1)Cc1cc(-c3cnc(C(C)(C)C)[nH]3)ccc1-2 |
| InChI | InChI=1S/C24H28N2/c1-23(2,3)18-8-10-20-17(13-18)12-16-11-15(7-9-19(16)20)21-14-25-22(26-21)24(4,5)6/h7-11,13-14H,12H2,1-6H3,(H,25,26) |
| InChIKey | SIFPCYYYKILJHY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |