About 3,7-dimethyl-4,9-dihydro-3H-fluorene
3,7-dimethyl-4,9-dihydro-3H-fluorene (PubChem CID 144517340) has the molecular formula C15H16
and a molecular weight of 196.29 g/mol. Its IUPAC name is 3,7-dimethyl-4,9-dihydro-3H-fluorene.
Molecular Properties
| Compound Name | 3,7-dimethyl-4,9-dihydro-3H-fluorene |
| PubChem CID | 144517340 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3,7-dimethyl-4,9-dihydro-3H-fluorene |
| SMILES | Cc1ccc2c(c1)CC1=C2CC(C)C=C1 |
| InChI | InChI=1S/C15H16/c1-10-4-6-14-13(7-10)9-12-5-3-11(2)8-15(12)14/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | UVFZFGNOFQFZIZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,7-dimethyl-4,9-dihydro-3H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-4,9-dihydro-3H-fluorene?
The IUPAC name of 3,7-dimethyl-4,9-dihydro-3H-fluorene (CID 144517340) is 3,7-dimethyl-4,9-dihydro-3H-fluorene.
What is the SMILES notation for 3,7-dimethyl-4,9-dihydro-3H-fluorene?
The canonical SMILES for 3,7-dimethyl-4,9-dihydro-3H-fluorene is Cc1ccc2c(c1)CC1=C2CC(C)C=C1.
What is the InChIKey of 3,7-dimethyl-4,9-dihydro-3H-fluorene?
The InChIKey is UVFZFGNOFQFZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16/c1-10-4-6-14-13(7-10)9-12-5-3-11(2)8-15(12)14/h3-7,11H,8-9H2,1-2H3.
What are the key properties of 3,7-dimethyl-4,9-dihydro-3H-fluorene?
3,7-dimethyl-4,9-dihydro-3H-fluorene has a molecular weight of 196.29 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-4,9-dihydro-3H-fluorene is sourced from PubChem (CID 144517340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).