C15H16 — CID 144517340
3,7-dimethyl-4,9-dihydro-3H-fluorene (PubChem CID 144517340) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is 3,7-dimethyl-4,9-dihydro-3H-fluorene.
| Compound Name | 3,7-dimethyl-4,9-dihydro-3H-fluorene |
|---|---|
| PubChem CID | 144517340 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3,7-dimethyl-4,9-dihydro-3H-fluorene |
| SMILES | Cc1ccc2c(c1)CC1=C2CC(C)C=C1 |
| InChI | InChI=1S/C15H16/c1-10-4-6-14-13(7-10)9-12-5-3-11(2)8-15(12)14/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | UVFZFGNOFQFZIZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |