C10H12S — CID 143335332
3,6-dimethyl-6,7-dihydro-1-benzothiophene (PubChem CID 143335332) has the molecular formula C10H12S and a molecular weight of 164.27 g/mol. Its IUPAC name is 3,6-dimethyl-6,7-dihydro-1-benzothiophene.
| Compound Name | 3,6-dimethyl-6,7-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 143335332 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 3,6-dimethyl-6,7-dihydro-1-benzothiophene |
| SMILES | Cc1csc2c1C=CC(C)C2 |
| InChI | InChI=1S/C10H12S/c1-7-3-4-9-8(2)6-11-10(9)5-7/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | ZPYNJINKKCQLDJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |