C7H8Br2 — CID 163708440
1,2-dibromo-5-methylcyclohexa-1,3-diene (PubChem CID 163708440) has the molecular formula C7H8Br2 and a molecular weight of 251.95 g/mol. Its IUPAC name is 1,2-dibromo-5-methylcyclohexa-1,3-diene.
| Compound Name | 1,2-dibromo-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163708440 |
| Molecular Formula | C7H8Br2 |
| Molecular Weight | 251.95 g/mol |
| Exact Mass | 249.90 |
| IUPAC Name | 1,2-dibromo-5-methylcyclohexa-1,3-diene |
| SMILES | CC1C=CC(Br)=C(Br)C1 |
| InChI | InChI=1S/C7H8Br2/c1-5-2-3-6(8)7(9)4-5/h2-3,5H,4H2,1H3 |
| InChIKey | KHCQDABYBAEBSQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.95 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |