C17H28 — CID 141114864
2,5,5,6,7,8,8-heptamethyl-1,2,6,7-tetrahydronaphthalene (PubChem CID 141114864) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 2,5,5,6,7,8,8-heptamethyl-1,2,6,7-tetrahydronaphthalene.
| Compound Name | 2,5,5,6,7,8,8-heptamethyl-1,2,6,7-tetrahydronaphthalene |
|---|---|
| PubChem CID | 141114864 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 2,5,5,6,7,8,8-heptamethyl-1,2,6,7-tetrahydronaphthalene |
| SMILES | CC1C=CC2=C(C1)C(C)(C)C(C)C(C)C2(C)C |
| InChI | InChI=1S/C17H28/c1-11-8-9-14-15(10-11)17(6,7)13(3)12(2)16(14,4)5/h8-9,11-13H,10H2,1-7H3 |
| InChIKey | VMERVFVWFJFEES-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |